mirror of
https://github.com/slint-ui/slint.git
synced 2025-10-04 07:34:39 +00:00

Avoid creating an intermediate array of items to free the graphics resources. Instead call run-time function with the item tree as a parameter, which is traversed. It's practically the same data structure that was previously created, except that it is shared/global and has little holes for the dynamic tree items, but those are easy to skip.
1703 lines
69 KiB
Rust
1703 lines
69 KiB
Rust
/* LICENSE BEGIN
|
|
This file is part of the SixtyFPS Project -- https://sixtyfps.io
|
|
Copyright (c) 2021 Olivier Goffart <olivier.goffart@sixtyfps.io>
|
|
Copyright (c) 2021 Simon Hausmann <simon.hausmann@sixtyfps.io>
|
|
|
|
SPDX-License-Identifier: GPL-3.0-only
|
|
This file is also available under commercial licensing terms.
|
|
Please contact info@sixtyfps.io for more information.
|
|
LICENSE END */
|
|
|
|
// cspell:ignore corelib SFPS QWIDGETSIZE pixmap qpointf qreal Antialiasing ARGB Rgba
|
|
|
|
use cpp::*;
|
|
use euclid::approxeq::ApproxEq;
|
|
use items::{ImageFit, TextHorizontalAlignment, TextVerticalAlignment};
|
|
use sixtyfps_corelib::graphics::{
|
|
Brush, FontRequest, Image, Point, Rect, RenderingCache, SharedImageBuffer, Size,
|
|
};
|
|
use sixtyfps_corelib::input::{InternalKeyCode, KeyEvent, KeyEventType, MouseEvent};
|
|
use sixtyfps_corelib::item_rendering::{CachedRenderingData, ItemRenderer};
|
|
use sixtyfps_corelib::items::{
|
|
self, FillRule, ImageRendering, ItemRef, PointerEventButton, TextOverflow, TextWrap,
|
|
};
|
|
use sixtyfps_corelib::layout::Orientation;
|
|
use sixtyfps_corelib::window::{PlatformWindow, PopupWindow, PopupWindowLocation, WindowRc};
|
|
use sixtyfps_corelib::{component::ComponentRc, SharedString};
|
|
use sixtyfps_corelib::{ImageInner, PathData, Property};
|
|
|
|
use std::cell::RefCell;
|
|
use std::pin::Pin;
|
|
use std::ptr::NonNull;
|
|
use std::rc::{Rc, Weak};
|
|
|
|
use crate::key_generated;
|
|
|
|
cpp! {{
|
|
#include <QtWidgets/QtWidgets>
|
|
#include <QtWidgets/QGraphicsScene>
|
|
#include <QtWidgets/QGraphicsBlurEffect>
|
|
#include <QtWidgets/QGraphicsPixmapItem>
|
|
#include <QtGui/QPainter>
|
|
#include <QtGui/QPaintEngine>
|
|
#include <QtGui/QPainterPath>
|
|
#include <QtGui/QWindow>
|
|
#include <QtGui/QResizeEvent>
|
|
#include <QtGui/QTextLayout>
|
|
#include <QtGui/QImageReader>
|
|
#include <QtCore/QBasicTimer>
|
|
#include <QtCore/QTimer>
|
|
#include <QtCore/QPointer>
|
|
#include <QtCore/QBuffer>
|
|
#include <QtCore/QEvent>
|
|
#include <QtCore/QFileInfo>
|
|
#include <memory>
|
|
void ensure_initialized();
|
|
|
|
struct TimerHandler : QObject {
|
|
QBasicTimer timer;
|
|
static TimerHandler& instance() {
|
|
static TimerHandler instance;
|
|
return instance;
|
|
}
|
|
|
|
void timerEvent(QTimerEvent *event) override {
|
|
if (event->timerId() != timer.timerId()) {
|
|
QObject::timerEvent(event);
|
|
return;
|
|
}
|
|
timer.stop();
|
|
rust!(SFPS_timerEvent [] { timer_event() });
|
|
}
|
|
|
|
};
|
|
|
|
struct SixtyFPSWidget : QWidget {
|
|
void *rust_window;
|
|
|
|
SixtyFPSWidget() {
|
|
setMouseTracking(true);
|
|
setFocusPolicy(Qt::StrongFocus);
|
|
}
|
|
|
|
void paintEvent(QPaintEvent *) override {
|
|
QPainter painter(this);
|
|
painter.setClipRect(rect());
|
|
painter.setRenderHints(QPainter::Antialiasing | QPainter::SmoothPixmapTransform);
|
|
auto painter_ptr = &painter;
|
|
rust!(SFPS_paintEvent [rust_window: &QtWindow as "void*", painter_ptr: &mut QPainter as "QPainter*"] {
|
|
rust_window.paint_event(painter_ptr)
|
|
});
|
|
}
|
|
|
|
void resizeEvent(QResizeEvent *event) override {
|
|
QSize size = event->size();
|
|
rust!(SFPS_resizeEvent [rust_window: &QtWindow as "void*", size: qttypes::QSize as "QSize"] {
|
|
rust_window.resize_event(size)
|
|
});
|
|
}
|
|
|
|
void mousePressEvent(QMouseEvent *event) override {
|
|
QPoint pos = event->pos();
|
|
int button = event->button();
|
|
rust!(SFPS_mousePressEvent [rust_window: &QtWindow as "void*", pos: qttypes::QPoint as "QPoint", button: u32 as "int" ] {
|
|
let pos = Point::new(pos.x as _, pos.y as _);
|
|
let button = from_qt_button(button);
|
|
rust_window.mouse_event(MouseEvent::MousePressed{ pos, button })
|
|
});
|
|
}
|
|
void mouseReleaseEvent(QMouseEvent *event) override {
|
|
QPoint pos = event->pos();
|
|
int button = event->button();
|
|
rust!(SFPS_mouseReleaseEvent [rust_window: &QtWindow as "void*", pos: qttypes::QPoint as "QPoint", button: u32 as "int" ] {
|
|
let pos = Point::new(pos.x as _, pos.y as _);
|
|
let button = from_qt_button(button);
|
|
rust_window.mouse_event(MouseEvent::MouseReleased{ pos, button })
|
|
});
|
|
if (auto p = dynamic_cast<const SixtyFPSWidget*>(parent())) {
|
|
// FIXME: better way to close the popup
|
|
void *parent_window = p->rust_window;
|
|
rust!(SFPS_mouseReleaseEventPopup [parent_window: &QtWindow as "void*", pos: qttypes::QPoint as "QPoint"] {
|
|
parent_window.close_popup();
|
|
});
|
|
}
|
|
}
|
|
void mouseMoveEvent(QMouseEvent *event) override {
|
|
QPoint pos = event->pos();
|
|
rust!(SFPS_mouseMoveEvent [rust_window: &QtWindow as "void*", pos: qttypes::QPoint as "QPoint"] {
|
|
let pos = Point::new(pos.x as _, pos.y as _);
|
|
rust_window.mouse_event(MouseEvent::MouseMoved{pos})
|
|
});
|
|
}
|
|
void wheelEvent(QWheelEvent *event) override {
|
|
QPointF pos = event->position();
|
|
QPoint delta = event->pixelDelta();
|
|
if (delta.isNull()) {
|
|
delta = event->angleDelta();
|
|
}
|
|
rust!(SFPS_mouseWheelEvent [rust_window: &QtWindow as "void*", pos: qttypes::QPointF as "QPointF", delta: qttypes::QPoint as "QPoint"] {
|
|
let pos = Point::new(pos.x as _, pos.y as _);
|
|
let delta = Point::new(delta.x as _, delta.y as _);
|
|
rust_window.mouse_event(MouseEvent::MouseWheel{pos, delta})
|
|
});
|
|
}
|
|
|
|
void keyPressEvent(QKeyEvent *event) override {
|
|
uint modifiers = uint(event->modifiers());
|
|
QString text = event->text();
|
|
int key = event->key();
|
|
rust!(SFPS_keyPress [rust_window: &QtWindow as "void*", key: i32 as "int", text: qttypes::QString as "QString", modifiers: u32 as "uint"] {
|
|
rust_window.key_event(key, text.clone(), modifiers, false);
|
|
});
|
|
}
|
|
void keyReleaseEvent(QKeyEvent *event) override {
|
|
uint modifiers = uint(event->modifiers());
|
|
QString text = event->text();
|
|
int key = event->key();
|
|
rust!(SFPS_keyRelease [rust_window: &QtWindow as "void*", key: i32 as "int", text: qttypes::QString as "QString", modifiers: u32 as "uint"] {
|
|
rust_window.key_event(key, text.clone(), modifiers, true);
|
|
});
|
|
}
|
|
|
|
void customEvent(QEvent *event) override {
|
|
if (event->type() == QEvent::User) {
|
|
rust!(SFPS_updateWindowProps [rust_window: &QtWindow as "void*"]{
|
|
if let Some(window) = rust_window.self_weak.upgrade() { window.update_window_properties() }
|
|
});
|
|
} else {
|
|
QWidget::customEvent(event);
|
|
}
|
|
}
|
|
|
|
void changeEvent(QEvent *event) override {
|
|
if (event->type() == QEvent::ActivationChange) {
|
|
bool active = isActiveWindow();
|
|
rust!(SFPS_updateWindowActivation [rust_window: &QtWindow as "void*", active: bool as "bool"]{
|
|
if let Some(window) = rust_window.self_weak.upgrade() { window.set_active(active) }
|
|
});
|
|
}
|
|
QWidget::changeEvent(event);
|
|
}
|
|
|
|
QSize sizeHint() const override {
|
|
auto preferred_size = rust!(SFPS_sizeHint [rust_window: &QtWindow as "void*"] -> qttypes::QSize as "QSize" {
|
|
let component_rc = rust_window.self_weak.upgrade().unwrap().component();
|
|
let component = ComponentRc::borrow_pin(&component_rc);
|
|
let layout_info_h = component.as_ref().layout_info(Orientation::Horizontal);
|
|
let layout_info_v = component.as_ref().layout_info(Orientation::Vertical);
|
|
qttypes::QSize {
|
|
width: layout_info_h.preferred_bounded() as _,
|
|
height: layout_info_v.preferred_bounded() as _,
|
|
}
|
|
});
|
|
if (!preferred_size.isEmpty()) {
|
|
return preferred_size;
|
|
} else {
|
|
return QWidget::sizeHint();
|
|
}
|
|
}
|
|
};
|
|
|
|
// Helper function used for the TextInput layouting
|
|
//
|
|
// if line_for_y_pos > 0, then the function will return the line at this y position
|
|
static int do_text_layout(QTextLayout &layout, int flags, const QRectF &rect, int line_for_y_pos = -1) {
|
|
QTextOption options;
|
|
options.setWrapMode((flags & Qt::TextWordWrap) ? QTextOption::WordWrap : QTextOption::NoWrap);
|
|
layout.setTextOption(options);
|
|
layout.setCacheEnabled(true);
|
|
QFontMetrics fm(layout.font());
|
|
int leading = fm.leading();
|
|
qreal height = 0;
|
|
layout.beginLayout();
|
|
int count = 0;
|
|
while(1) {
|
|
auto line = layout.createLine();
|
|
if (!line.isValid())
|
|
break;
|
|
line.setLineWidth(rect.width());
|
|
height += leading;
|
|
line.setPosition(QPointF(0, height));
|
|
height += line.height();
|
|
if (line_for_y_pos >= 0 && height > line_for_y_pos) {
|
|
return count;
|
|
}
|
|
count++;
|
|
}
|
|
layout.endLayout();
|
|
if (flags & Qt::AlignVCenter) {
|
|
layout.setPosition(QPointF(0, (rect.height() - height) / 2.));
|
|
} else if (flags & Qt::AlignBottom) {
|
|
layout.setPosition(QPointF(0, rect.height() - height));
|
|
}
|
|
return -1;
|
|
}
|
|
}}
|
|
|
|
cpp_class! {pub unsafe struct QPainter as "QPainter"}
|
|
|
|
impl QPainter {
|
|
pub fn save_state(&mut self) {
|
|
cpp! { unsafe [self as "QPainter*"] {
|
|
self->save();
|
|
}}
|
|
}
|
|
|
|
pub fn restore_state(&mut self) {
|
|
cpp! { unsafe [self as "QPainter*"] {
|
|
self->restore();
|
|
}}
|
|
}
|
|
}
|
|
|
|
cpp_class! {pub unsafe struct QPainterPath as "QPainterPath"}
|
|
|
|
impl QPainterPath {
|
|
/*
|
|
pub fn reserve(&mut self, size: usize) {
|
|
cpp! { unsafe [self as "QPainterPath*", size as "long long"] {
|
|
self->reserve(size);
|
|
}}
|
|
}*/
|
|
|
|
pub fn move_to(&mut self, to: qttypes::QPointF) {
|
|
cpp! { unsafe [self as "QPainterPath*", to as "QPointF"] {
|
|
self->moveTo(to);
|
|
}}
|
|
}
|
|
pub fn line_to(&mut self, to: qttypes::QPointF) {
|
|
cpp! { unsafe [self as "QPainterPath*", to as "QPointF"] {
|
|
self->lineTo(to);
|
|
}}
|
|
}
|
|
pub fn quad_to(&mut self, ctrl: qttypes::QPointF, to: qttypes::QPointF) {
|
|
cpp! { unsafe [self as "QPainterPath*", ctrl as "QPointF", to as "QPointF"] {
|
|
self->quadTo(ctrl, to);
|
|
}}
|
|
}
|
|
pub fn cubic_to(
|
|
&mut self,
|
|
ctrl1: qttypes::QPointF,
|
|
ctrl2: qttypes::QPointF,
|
|
to: qttypes::QPointF,
|
|
) {
|
|
cpp! { unsafe [self as "QPainterPath*", ctrl1 as "QPointF", ctrl2 as "QPointF", to as "QPointF"] {
|
|
self->cubicTo(ctrl1, ctrl2, to);
|
|
}}
|
|
}
|
|
|
|
pub fn close(&mut self) {
|
|
cpp! { unsafe [self as "QPainterPath*"] {
|
|
self->closeSubpath();
|
|
}}
|
|
}
|
|
|
|
pub fn set_fill_rule(&mut self, rule: key_generated::Qt_FillRule) {
|
|
cpp! { unsafe [self as "QPainterPath*", rule as "Qt::FillRule" ] {
|
|
self->setFillRule(rule);
|
|
}}
|
|
}
|
|
}
|
|
|
|
cpp_class!(
|
|
pub unsafe struct QBrush as "QBrush"
|
|
);
|
|
|
|
impl std::convert::From<sixtyfps_corelib::Brush> for QBrush {
|
|
fn from(brush: sixtyfps_corelib::Brush) -> Self {
|
|
match brush {
|
|
sixtyfps_corelib::Brush::SolidColor(color) => {
|
|
let color: u32 = color.as_argb_encoded();
|
|
cpp!(unsafe [color as "QRgb"] -> QBrush as "QBrush" {
|
|
return QBrush(QColor::fromRgba(color));
|
|
})
|
|
}
|
|
sixtyfps_corelib::Brush::LinearGradient(g) => {
|
|
let (start, end) = sixtyfps_corelib::graphics::line_for_angle(g.angle());
|
|
let p1 = qttypes::QPointF { x: start.x as _, y: start.y as _ };
|
|
let p2 = qttypes::QPointF { x: end.x as _, y: end.y as _ };
|
|
cpp_class!(unsafe struct QLinearGradient as "QLinearGradient");
|
|
let mut qlg = cpp! {
|
|
unsafe [p1 as "QPointF", p2 as "QPointF"] -> QLinearGradient as "QLinearGradient" {
|
|
QLinearGradient qlg(p1, p2);
|
|
qlg.setCoordinateMode(QGradient::ObjectMode);
|
|
return qlg;
|
|
}
|
|
};
|
|
for s in g.stops() {
|
|
let pos: f32 = s.position;
|
|
let color: u32 = s.color.as_argb_encoded();
|
|
cpp! {unsafe [mut qlg as "QLinearGradient", pos as "float", color as "QRgb"] {
|
|
qlg.setColorAt(pos, QColor::fromRgba(color));
|
|
}};
|
|
}
|
|
cpp! {unsafe [qlg as "QLinearGradient"] -> QBrush as "QBrush" {
|
|
return QBrush(qlg);
|
|
}}
|
|
}
|
|
_ => QBrush::default(),
|
|
}
|
|
}
|
|
}
|
|
|
|
fn from_qt_button(qt_button: u32) -> PointerEventButton {
|
|
match qt_button {
|
|
1 => PointerEventButton::left,
|
|
2 => PointerEventButton::right,
|
|
4 => PointerEventButton::middle,
|
|
_ => PointerEventButton::none,
|
|
}
|
|
}
|
|
|
|
/// Given a position offset and an object of a given type that has x,y,width,height properties,
|
|
/// create a QRectF that fits it.
|
|
macro_rules! get_geometry {
|
|
($ty:ty, $obj:expr) => {{
|
|
type Ty = $ty;
|
|
let width = Ty::FIELD_OFFSETS.width.apply_pin($obj).get();
|
|
let height = Ty::FIELD_OFFSETS.height.apply_pin($obj).get();
|
|
if width <= 0. || height <= 0. {
|
|
return Default::default();
|
|
};
|
|
qttypes::QRectF { x: 0., y: 0., width: width as _, height: height as _ }
|
|
}};
|
|
}
|
|
|
|
fn adjust_rect_and_border_for_inner_drawing(rect: &mut qttypes::QRectF, border_width: &mut f32) {
|
|
// If the border width exceeds the width, just fill the rectangle.
|
|
*border_width = border_width.min((rect.width as f32) / 2.);
|
|
// adjust the size so that the border is drawn within the geometry
|
|
rect.x += *border_width as f64 / 2.;
|
|
rect.y += *border_width as f64 / 2.;
|
|
rect.width -= *border_width as f64;
|
|
rect.height -= *border_width as f64;
|
|
}
|
|
|
|
#[derive(Clone)]
|
|
enum QtRenderingCacheItem {
|
|
Pixmap(qttypes::QPixmap),
|
|
Invalid,
|
|
}
|
|
|
|
impl Default for QtRenderingCacheItem {
|
|
fn default() -> Self {
|
|
Self::Invalid
|
|
}
|
|
}
|
|
|
|
type QtRenderingCache = Rc<RefCell<RenderingCache<QtRenderingCacheItem>>>;
|
|
|
|
struct QtItemRenderer<'a> {
|
|
painter: &'a mut QPainter,
|
|
cache: QtRenderingCache,
|
|
default_font_properties: FontRequest,
|
|
window: WindowRc,
|
|
}
|
|
|
|
impl ItemRenderer for QtItemRenderer<'_> {
|
|
fn draw_rectangle(&mut self, rect: Pin<&items::Rectangle>) {
|
|
let brush: QBrush = rect.background().into();
|
|
let rect: qttypes::QRectF = get_geometry!(items::Rectangle, rect);
|
|
let painter: &mut QPainter = &mut *self.painter;
|
|
cpp! { unsafe [painter as "QPainter*", brush as "QBrush", rect as "QRectF"] {
|
|
painter->fillRect(rect, brush);
|
|
}}
|
|
}
|
|
|
|
fn draw_border_rectangle(&mut self, rect: std::pin::Pin<&items::BorderRectangle>) {
|
|
Self::draw_rectangle_impl(
|
|
self.painter,
|
|
get_geometry!(items::BorderRectangle, rect),
|
|
rect.background(),
|
|
rect.border_color(),
|
|
rect.border_width(),
|
|
rect.border_radius(),
|
|
);
|
|
}
|
|
|
|
fn draw_image(&mut self, image: Pin<&items::ImageItem>) {
|
|
let dest_rect: qttypes::QRectF = get_geometry!(items::ImageItem, image);
|
|
self.draw_image_impl(
|
|
&image.cached_rendering_data,
|
|
items::ImageItem::FIELD_OFFSETS.source.apply_pin(image),
|
|
dest_rect,
|
|
None,
|
|
items::ImageItem::FIELD_OFFSETS.width.apply_pin(image),
|
|
items::ImageItem::FIELD_OFFSETS.height.apply_pin(image),
|
|
image.image_fit(),
|
|
image.image_rendering(),
|
|
None,
|
|
);
|
|
}
|
|
|
|
fn draw_clipped_image(&mut self, image: Pin<&items::ClippedImage>) {
|
|
let dest_rect: qttypes::QRectF = get_geometry!(items::ClippedImage, image);
|
|
let source_rect = qttypes::QRectF {
|
|
x: image.source_clip_x() as _,
|
|
y: image.source_clip_y() as _,
|
|
width: image.source_clip_width() as _,
|
|
height: image.source_clip_height() as _,
|
|
};
|
|
self.draw_image_impl(
|
|
&image.cached_rendering_data,
|
|
items::ClippedImage::FIELD_OFFSETS.source.apply_pin(image),
|
|
dest_rect,
|
|
Some(source_rect),
|
|
items::ClippedImage::FIELD_OFFSETS.width.apply_pin(image),
|
|
items::ClippedImage::FIELD_OFFSETS.height.apply_pin(image),
|
|
image.image_fit(),
|
|
image.image_rendering(),
|
|
Some(items::ClippedImage::FIELD_OFFSETS.colorize.apply_pin(image)),
|
|
);
|
|
}
|
|
|
|
fn draw_text(&mut self, text: std::pin::Pin<&items::Text>) {
|
|
let rect: qttypes::QRectF = get_geometry!(items::Text, text);
|
|
let fill_brush: QBrush = text.color().into();
|
|
let mut string: qttypes::QString = text.text().as_str().into();
|
|
let font: QFont =
|
|
get_font(text.unresolved_font_request().merge(&self.default_font_properties));
|
|
let flags = match text.horizontal_alignment() {
|
|
TextHorizontalAlignment::left => key_generated::Qt_AlignmentFlag_AlignLeft,
|
|
TextHorizontalAlignment::center => key_generated::Qt_AlignmentFlag_AlignHCenter,
|
|
TextHorizontalAlignment::right => key_generated::Qt_AlignmentFlag_AlignRight,
|
|
} | match text.vertical_alignment() {
|
|
TextVerticalAlignment::top => key_generated::Qt_AlignmentFlag_AlignTop,
|
|
TextVerticalAlignment::center => key_generated::Qt_AlignmentFlag_AlignVCenter,
|
|
TextVerticalAlignment::bottom => key_generated::Qt_AlignmentFlag_AlignBottom,
|
|
} | match text.wrap() {
|
|
TextWrap::no_wrap => 0,
|
|
TextWrap::word_wrap => key_generated::Qt_TextFlag_TextWordWrap,
|
|
};
|
|
let elide = text.overflow() == TextOverflow::elide;
|
|
let painter: &mut QPainter = &mut *self.painter;
|
|
cpp! { unsafe [painter as "QPainter*", rect as "QRectF", fill_brush as "QBrush", mut string as "QString", flags as "int", font as "QFont", elide as "bool"] {
|
|
painter->setFont(font);
|
|
painter->setPen(QPen(fill_brush, 0));
|
|
painter->setBrush(Qt::NoBrush);
|
|
if (!elide) {
|
|
painter->drawText(rect, flags, string);
|
|
} else if (!(flags & Qt::TextWordWrap)) {
|
|
QString elided;
|
|
QFontMetrics fm(font);
|
|
while (!string.isEmpty()) {
|
|
int pos = string.indexOf('\n');
|
|
if (pos < 0) {
|
|
elided += fm.elidedText(string, Qt::ElideRight, rect.width());
|
|
break;
|
|
}
|
|
QString line = string.left(pos);
|
|
elided += fm.elidedText(line, Qt::ElideRight, rect.width());
|
|
elided += '\n';
|
|
string = string.mid(pos + 1);
|
|
}
|
|
painter->drawText(rect, flags, elided);
|
|
} else {
|
|
// elide and word wrap: we need to add the ellipsis manually on the last line
|
|
string.replace(QChar('\n'), QChar::LineSeparator);
|
|
QString elided = string;
|
|
QFontMetrics fm(font);
|
|
QTextLayout layout(string, font);
|
|
QTextOption options;
|
|
options.setWrapMode(QTextOption::WordWrap);
|
|
layout.setTextOption(options);
|
|
layout.setCacheEnabled(true);
|
|
layout.beginLayout();
|
|
int leading = fm.leading();
|
|
qreal height = 0;
|
|
int last_line_begin = 0, last_line_size = 0;
|
|
while (true) {
|
|
auto line = layout.createLine();
|
|
if (!line.isValid()) {
|
|
last_line_begin = string.size();
|
|
break;
|
|
}
|
|
line.setLineWidth(rect.width());
|
|
height += leading + line.height();
|
|
if (height > rect.height()) {
|
|
break;
|
|
}
|
|
last_line_begin = line.textStart();
|
|
last_line_size = line.textLength();
|
|
}
|
|
if (last_line_begin < string.size()) {
|
|
elided = string.left(last_line_begin);
|
|
QString to_elide = QStringView(string).mid(last_line_begin, last_line_size).trimmed() % QStringView(u"…");
|
|
elided += fm.elidedText(to_elide, Qt::ElideRight, rect.width());
|
|
}
|
|
painter->drawText(rect, flags, elided);
|
|
}
|
|
}}
|
|
}
|
|
|
|
fn draw_text_input(&mut self, text_input: std::pin::Pin<&items::TextInput>) {
|
|
let rect: qttypes::QRectF = get_geometry!(items::TextInput, text_input);
|
|
let fill_brush: QBrush = text_input.color().into();
|
|
let selection_foreground_color: u32 =
|
|
text_input.selection_foreground_color().as_argb_encoded();
|
|
let selection_background_color: u32 =
|
|
text_input.selection_background_color().as_argb_encoded();
|
|
|
|
let text = text_input.text();
|
|
let mut string: qttypes::QString = text.as_str().into();
|
|
let font: QFont =
|
|
get_font(text_input.unresolved_font_request().merge(&self.default_font_properties));
|
|
let flags = match text_input.horizontal_alignment() {
|
|
TextHorizontalAlignment::left => key_generated::Qt_AlignmentFlag_AlignLeft,
|
|
TextHorizontalAlignment::center => key_generated::Qt_AlignmentFlag_AlignHCenter,
|
|
TextHorizontalAlignment::right => key_generated::Qt_AlignmentFlag_AlignRight,
|
|
} | match text_input.vertical_alignment() {
|
|
TextVerticalAlignment::top => key_generated::Qt_AlignmentFlag_AlignTop,
|
|
TextVerticalAlignment::center => key_generated::Qt_AlignmentFlag_AlignVCenter,
|
|
TextVerticalAlignment::bottom => key_generated::Qt_AlignmentFlag_AlignBottom,
|
|
} | match text_input.wrap() {
|
|
TextWrap::no_wrap => 0,
|
|
TextWrap::word_wrap => key_generated::Qt_TextFlag_TextWordWrap,
|
|
};
|
|
|
|
// convert byte offsets to offsets in Qt UTF-16 encoded string, as that's
|
|
// what QTextLayout expects.
|
|
let cursor_position_as_offset: i32 = text_input.cursor_position();
|
|
let anchor_position_as_offset: i32 = text_input.anchor_position();
|
|
let cursor_position: i32 = if cursor_position_as_offset > 0 {
|
|
utf8_byte_offset_to_utf16_units(text.as_str(), cursor_position_as_offset as usize)
|
|
as i32
|
|
} else {
|
|
0
|
|
};
|
|
let anchor_position: i32 = if anchor_position_as_offset > 0 {
|
|
utf8_byte_offset_to_utf16_units(text.as_str(), anchor_position_as_offset as usize)
|
|
as i32
|
|
} else {
|
|
0
|
|
};
|
|
|
|
let text_cursor_width: f32 = if text_input.cursor_visible() && text_input.enabled() {
|
|
text_input.text_cursor_width()
|
|
} else {
|
|
0.
|
|
};
|
|
|
|
let single_line: bool = text_input.single_line();
|
|
|
|
let painter: &mut QPainter = &mut *self.painter;
|
|
cpp! { unsafe [
|
|
painter as "QPainter*",
|
|
rect as "QRectF",
|
|
fill_brush as "QBrush",
|
|
selection_foreground_color as "QRgb",
|
|
selection_background_color as "QRgb",
|
|
mut string as "QString",
|
|
flags as "int",
|
|
single_line as "bool",
|
|
font as "QFont",
|
|
cursor_position as "int",
|
|
anchor_position as "int",
|
|
text_cursor_width as "float"] {
|
|
if (!single_line) {
|
|
string.replace(QChar('\n'), QChar::LineSeparator);
|
|
}
|
|
QTextLayout layout(string, font);
|
|
do_text_layout(layout, flags, rect);
|
|
painter->setPen(QPen(fill_brush, 0));
|
|
QVector<QTextLayout::FormatRange> selections;
|
|
if (anchor_position != cursor_position) {
|
|
QTextCharFormat fmt;
|
|
fmt.setBackground(QColor::fromRgba(selection_background_color));
|
|
fmt.setForeground(QColor::fromRgba(selection_foreground_color));
|
|
selections << QTextLayout::FormatRange{
|
|
std::min(anchor_position, cursor_position),
|
|
std::abs(anchor_position - cursor_position),
|
|
fmt
|
|
};
|
|
}
|
|
layout.draw(painter, rect.topLeft(), selections);
|
|
if (text_cursor_width > 0) {
|
|
layout.drawCursor(painter, rect.topLeft(), cursor_position, text_cursor_width);
|
|
}
|
|
}}
|
|
}
|
|
|
|
fn draw_path(&mut self, path: Pin<&items::Path>) {
|
|
let elements = path.elements();
|
|
if matches!(elements, PathData::None) {
|
|
return;
|
|
}
|
|
// FIXME: handle width/height
|
|
//let rect: qttypes::QRectF = get_geometry!(pos, items::Path, path);
|
|
let fill_brush: QBrush = path.fill().into();
|
|
let stroke_brush: QBrush = path.stroke().into();
|
|
let stroke_width: f32 = path.stroke_width();
|
|
let (offset, path_events) = path.fitted_path_events();
|
|
let pos = qttypes::QPoint { x: offset.x as _, y: offset.y as _ };
|
|
let mut painter_path = QPainterPath::default();
|
|
|
|
painter_path.set_fill_rule(match path.fill_rule() {
|
|
FillRule::nonzero => key_generated::Qt_FillRule_WindingFill,
|
|
FillRule::evenodd => key_generated::Qt_FillRule_OddEvenFill,
|
|
});
|
|
|
|
for x in path_events.iter() {
|
|
fn to_qpointf(p: Point) -> qttypes::QPointF {
|
|
qttypes::QPointF { x: p.x as _, y: p.y as _ }
|
|
}
|
|
match x {
|
|
lyon_path::Event::Begin { at } => {
|
|
painter_path.move_to(to_qpointf(at));
|
|
}
|
|
lyon_path::Event::Line { from: _, to } => {
|
|
painter_path.line_to(to_qpointf(to));
|
|
}
|
|
lyon_path::Event::Quadratic { from: _, ctrl, to } => {
|
|
painter_path.quad_to(to_qpointf(ctrl), to_qpointf(to));
|
|
}
|
|
|
|
lyon_path::Event::Cubic { from: _, ctrl1, ctrl2, to } => {
|
|
painter_path.cubic_to(to_qpointf(ctrl1), to_qpointf(ctrl2), to_qpointf(to));
|
|
}
|
|
lyon_path::Event::End { last: _, first: _, close } => {
|
|
// FIXME: are we supposed to do something with last and first?
|
|
if close {
|
|
painter_path.close()
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
let painter: &mut QPainter = &mut *self.painter;
|
|
cpp! { unsafe [
|
|
painter as "QPainter*",
|
|
pos as "QPoint",
|
|
mut painter_path as "QPainterPath",
|
|
fill_brush as "QBrush",
|
|
stroke_brush as "QBrush",
|
|
stroke_width as "float"] {
|
|
painter->save();
|
|
auto cleanup = qScopeGuard([&] { painter->restore(); });
|
|
painter->translate(pos);
|
|
painter->setPen(stroke_width > 0 ? QPen(stroke_brush, stroke_width) : Qt::NoPen);
|
|
painter->setBrush(fill_brush);
|
|
painter->drawPath(painter_path);
|
|
}}
|
|
}
|
|
|
|
fn draw_box_shadow(&mut self, box_shadow: Pin<&items::BoxShadow>) {
|
|
let cached_shadow_pixmap = box_shadow
|
|
.cached_rendering_data
|
|
.get_or_update(&self.cache, || {
|
|
let shadow_rect = get_geometry!(items::BoxShadow, box_shadow);
|
|
|
|
let source_size = qttypes::QSize {
|
|
width: shadow_rect.width.ceil() as _,
|
|
height: shadow_rect.height.ceil() as _,
|
|
};
|
|
|
|
let mut source_image =
|
|
qttypes::QImage::new(source_size, qttypes::ImageFormat::ARGB32_Premultiplied);
|
|
source_image.fill(qttypes::QColor::from_rgba_f(0., 0., 0., 0.));
|
|
|
|
let img = &mut source_image;
|
|
let mut painter_ =
|
|
cpp!(unsafe [img as "QImage*"] -> QPainter as "QPainter" { return QPainter(img); });
|
|
|
|
Self::draw_rectangle_impl(
|
|
&mut painter_,
|
|
qttypes::QRectF { x: 0., y: 0., width: shadow_rect.width, height: shadow_rect.height },
|
|
Brush::SolidColor(box_shadow.color()),
|
|
Brush::default(),
|
|
0.,
|
|
box_shadow.border_radius(),
|
|
);
|
|
|
|
drop(painter_);
|
|
|
|
let blur_radius = box_shadow.blur();
|
|
|
|
let shadow_pixmap = if blur_radius > 0. {
|
|
cpp! {
|
|
unsafe[img as "QImage*", blur_radius as "float"] -> qttypes::QPixmap as "QPixmap" {
|
|
class PublicGraphicsBlurEffect : public QGraphicsBlurEffect {
|
|
public:
|
|
// Make public what's protected
|
|
using QGraphicsBlurEffect::draw;
|
|
};
|
|
|
|
// Need a scene for the effect source private to draw()
|
|
QGraphicsScene scene;
|
|
|
|
auto pixmap_item = scene.addPixmap(QPixmap::fromImage(*img));
|
|
|
|
auto blur_effect = new PublicGraphicsBlurEffect;
|
|
blur_effect->setBlurRadius(blur_radius);
|
|
blur_effect->setBlurHints(QGraphicsBlurEffect::QualityHint);
|
|
|
|
// takes ownership of the effect and registers the item with
|
|
// the effect as source.
|
|
pixmap_item->setGraphicsEffect(blur_effect);
|
|
|
|
QImage blurred_scene(img->width() + 2 * blur_radius, img->height() + 2 * blur_radius, QImage::Format_ARGB32_Premultiplied);
|
|
blurred_scene.fill(Qt::transparent);
|
|
|
|
QPainter p(&blurred_scene);
|
|
p.translate(blur_radius, blur_radius);
|
|
blur_effect->draw(&p);
|
|
p.end();
|
|
|
|
return QPixmap::fromImage(blurred_scene);
|
|
}}
|
|
} else {
|
|
cpp! { unsafe[img as "QImage*"] -> qttypes::QPixmap as "QPixmap" {
|
|
return QPixmap::fromImage(*img);
|
|
}}
|
|
};
|
|
QtRenderingCacheItem::Pixmap(shadow_pixmap)
|
|
});
|
|
|
|
let pixmap: &qttypes::QPixmap = match &cached_shadow_pixmap {
|
|
QtRenderingCacheItem::Pixmap(pixmap) => pixmap,
|
|
_ => return,
|
|
};
|
|
|
|
let blur_radius = box_shadow.blur();
|
|
|
|
let shadow_offset = qttypes::QPointF {
|
|
x: (box_shadow.offset_x() - blur_radius) as f64,
|
|
y: (box_shadow.offset_y() - blur_radius) as f64,
|
|
};
|
|
|
|
let painter: &mut QPainter = &mut *self.painter;
|
|
cpp! { unsafe [
|
|
painter as "QPainter*",
|
|
shadow_offset as "QPointF",
|
|
pixmap as "QPixmap*"
|
|
] {
|
|
painter->drawPixmap(shadow_offset, *pixmap);
|
|
}}
|
|
}
|
|
|
|
fn combine_clip(&mut self, rect: Rect, radius: f32, mut border_width: f32) {
|
|
let mut clip_rect = qttypes::QRectF {
|
|
x: rect.min_x() as _,
|
|
y: rect.min_y() as _,
|
|
width: rect.width() as _,
|
|
height: rect.height() as _,
|
|
};
|
|
adjust_rect_and_border_for_inner_drawing(&mut clip_rect, &mut border_width);
|
|
let painter: &mut QPainter = &mut *self.painter;
|
|
cpp! { unsafe [painter as "QPainter*", clip_rect as "QRectF", radius as "float"] {
|
|
if (radius <= 0) {
|
|
painter->setClipRect(clip_rect, Qt::IntersectClip);
|
|
} else {
|
|
QPainterPath path;
|
|
path.addRoundedRect(clip_rect, radius, radius);
|
|
painter->setClipPath(path, Qt::IntersectClip);
|
|
}
|
|
}}
|
|
}
|
|
|
|
fn get_current_clip(&self) -> Rect {
|
|
let painter: &QPainter = self.painter;
|
|
let res = cpp! { unsafe [painter as "const QPainter*" ] -> qttypes::QRectF as "QRectF" {
|
|
return painter->clipBoundingRect();
|
|
}};
|
|
Rect::new(Point::new(res.x as _, res.y as _), Size::new(res.width as _, res.height as _))
|
|
}
|
|
|
|
fn save_state(&mut self) {
|
|
self.painter.save_state()
|
|
}
|
|
|
|
fn restore_state(&mut self) {
|
|
self.painter.restore_state()
|
|
}
|
|
|
|
fn scale_factor(&self) -> f32 {
|
|
1.
|
|
/* cpp! { unsafe [painter as "QPainter*"] -> f32 as "float" {
|
|
return painter->paintEngine()->paintDevice()->devicePixelRatioF();
|
|
}} */
|
|
}
|
|
|
|
fn draw_cached_pixmap(
|
|
&mut self,
|
|
_item_cache: &sixtyfps_corelib::item_rendering::CachedRenderingData,
|
|
update_fn: &dyn Fn(&mut dyn FnMut(u32, u32, &[u8])),
|
|
) {
|
|
update_fn(&mut |width: u32, height: u32, data: &[u8]| {
|
|
let data = data.as_ptr();
|
|
let painter: &mut QPainter = &mut *self.painter;
|
|
cpp! { unsafe [painter as "QPainter*", width as "int", height as "int", data as "const unsigned char *"] {
|
|
QImage img(data, width, height, width * 4, QImage::Format_RGBA8888_Premultiplied);
|
|
painter->drawImage(QPoint(), img);
|
|
}}
|
|
})
|
|
}
|
|
|
|
fn window(&self) -> WindowRc {
|
|
self.window.clone()
|
|
}
|
|
|
|
fn as_any(&mut self) -> &mut dyn std::any::Any {
|
|
self.painter
|
|
}
|
|
|
|
fn translate(&mut self, x: f32, y: f32) {
|
|
let painter: &mut QPainter = &mut *self.painter;
|
|
cpp! { unsafe [painter as "QPainter*", x as "float", y as "float"] {
|
|
painter->translate(x, y);
|
|
}}
|
|
}
|
|
|
|
fn rotate(&mut self, angle_in_degrees: f32) {
|
|
let painter: &mut QPainter = &mut *self.painter;
|
|
cpp! { unsafe [painter as "QPainter*", angle_in_degrees as "float"] {
|
|
painter->rotate(angle_in_degrees);
|
|
}}
|
|
}
|
|
|
|
fn apply_opacity(&mut self, opacity: f32) {
|
|
let painter: &mut QPainter = &mut *self.painter;
|
|
cpp! { unsafe [painter as "QPainter*", opacity as "float"] {
|
|
painter->setOpacity(painter->opacity() * opacity);
|
|
}}
|
|
}
|
|
}
|
|
|
|
pub(crate) fn load_image_from_resource(
|
|
resource: &ImageInner,
|
|
source_size: Option<qttypes::QSize>,
|
|
image_fit: ImageFit,
|
|
) -> Option<qttypes::QPixmap> {
|
|
let (is_path, data) = match resource {
|
|
ImageInner::None => return None,
|
|
ImageInner::AbsoluteFilePath(path) => (true, qttypes::QByteArray::from(path.as_str())),
|
|
ImageInner::EmbeddedData { data, format: _ } => {
|
|
(false, qttypes::QByteArray::from(data.as_slice()))
|
|
}
|
|
ImageInner::EmbeddedImage(buffer) => {
|
|
let (format, bytes_per_line, buffer_ptr) = match buffer {
|
|
SharedImageBuffer::RGBA8(img) => {
|
|
(qttypes::ImageFormat::RGBA8888, img.stride() * 4, img.as_bytes().as_ptr())
|
|
}
|
|
SharedImageBuffer::RGBA8Premultiplied(img) => (
|
|
qttypes::ImageFormat::RGBA8888_Premultiplied,
|
|
img.stride() * 4,
|
|
img.as_bytes().as_ptr(),
|
|
),
|
|
SharedImageBuffer::RGB8(img) => {
|
|
(qttypes::ImageFormat::RGB888, img.stride() * 3, img.as_bytes().as_ptr())
|
|
}
|
|
};
|
|
let width: i32 = buffer.width() as _;
|
|
let height: i32 = buffer.height() as _;
|
|
let pixmap = cpp! { unsafe [format as "QImage::Format", width as "int", height as "int", bytes_per_line as "size_t", buffer_ptr as "const uchar *"] -> qttypes::QPixmap as "QPixmap" {
|
|
QImage img(buffer_ptr, width, height, bytes_per_line, format);
|
|
return QPixmap::fromImage(img);
|
|
} };
|
|
return Some(pixmap);
|
|
}
|
|
};
|
|
let size_requested = is_svg(resource) && source_size.is_some();
|
|
let source_size = source_size.unwrap_or_default();
|
|
debug_assert_eq!(ImageFit::contain as i32, 1);
|
|
debug_assert_eq!(ImageFit::cover as i32, 2);
|
|
Some(cpp! { unsafe [
|
|
data as "QByteArray",
|
|
is_path as "bool",
|
|
size_requested as "bool",
|
|
source_size as "QSize",
|
|
image_fit as "int"] -> qttypes::QPixmap as "QPixmap" {
|
|
if (size_requested) {
|
|
QImageReader reader;
|
|
QBuffer buffer;
|
|
if (is_path) {
|
|
reader.setFileName(QString::fromUtf8(data));
|
|
} else {
|
|
buffer.setBuffer(const_cast<QByteArray *>(&data));
|
|
reader.setDevice(&buffer);
|
|
}
|
|
if (reader.supportsOption(QImageIOHandler::ScaledSize)) {
|
|
auto target_size = source_size;
|
|
if (image_fit == 1) { //ImageFit::contain
|
|
QSizeF s = reader.size();
|
|
target_size = (s * qMin(source_size.width() / s.width(), source_size.height() / s.height())).toSize();
|
|
} else if (image_fit == 2) { //ImageFit::cover
|
|
QSizeF s = reader.size();
|
|
target_size = (s * qMax(source_size.width() / s.width(), source_size.height() / s.height())).toSize();
|
|
}
|
|
reader.setScaledSize(target_size);
|
|
return QPixmap::fromImageReader(&reader);
|
|
}
|
|
}
|
|
QPixmap img;
|
|
is_path ? img.load(QString::fromUtf8(data)) : img.loadFromData(data);
|
|
return img;
|
|
}})
|
|
}
|
|
|
|
/// Changes the source or the destination rectangle to respect the image fit
|
|
fn adjust_to_image_fit(
|
|
image_fit: ImageFit,
|
|
source_rect: &mut qttypes::QRectF,
|
|
dest_rect: &mut qttypes::QRectF,
|
|
) {
|
|
match image_fit {
|
|
sixtyfps_corelib::items::ImageFit::fill => (),
|
|
sixtyfps_corelib::items::ImageFit::cover => {
|
|
let ratio = qttypes::qreal::max(
|
|
dest_rect.width / source_rect.width,
|
|
dest_rect.height / source_rect.height,
|
|
);
|
|
if source_rect.width > dest_rect.width / ratio {
|
|
source_rect.x += (source_rect.width - dest_rect.width / ratio) / 2.;
|
|
source_rect.width = dest_rect.width / ratio;
|
|
}
|
|
if source_rect.height > dest_rect.height / ratio {
|
|
source_rect.y += (source_rect.height - dest_rect.height / ratio) / 2.;
|
|
source_rect.height = dest_rect.height / ratio;
|
|
}
|
|
}
|
|
sixtyfps_corelib::items::ImageFit::contain => {
|
|
let ratio = qttypes::qreal::min(
|
|
dest_rect.width / source_rect.width,
|
|
dest_rect.height / source_rect.height,
|
|
);
|
|
if dest_rect.width > source_rect.width * ratio {
|
|
dest_rect.x += (dest_rect.width - source_rect.width * ratio) / 2.;
|
|
dest_rect.width = source_rect.width * ratio;
|
|
}
|
|
if dest_rect.height > source_rect.height * ratio {
|
|
dest_rect.y += (dest_rect.height - source_rect.height * ratio) / 2.;
|
|
dest_rect.height = source_rect.height * ratio;
|
|
}
|
|
}
|
|
};
|
|
}
|
|
|
|
/// Return true if this image is a SVG that is scalable
|
|
fn is_svg(resource: &ImageInner) -> bool {
|
|
match resource {
|
|
ImageInner::None => false,
|
|
ImageInner::AbsoluteFilePath(path) => {
|
|
path.as_str().ends_with(".svg") || path.as_str().ends_with(".svgz")
|
|
}
|
|
ImageInner::EmbeddedData { format, .. } => {
|
|
format.as_slice() == b"svg" || format.as_slice() == b"svgz"
|
|
}
|
|
ImageInner::EmbeddedImage { .. } => false,
|
|
}
|
|
}
|
|
|
|
impl QtItemRenderer<'_> {
|
|
fn draw_image_impl(
|
|
&mut self,
|
|
item_cache: &CachedRenderingData,
|
|
source_property: Pin<&Property<Image>>,
|
|
dest_rect: qttypes::QRectF,
|
|
source_rect: Option<qttypes::QRectF>,
|
|
target_width: std::pin::Pin<&Property<f32>>,
|
|
target_height: std::pin::Pin<&Property<f32>>,
|
|
image_fit: ImageFit,
|
|
rendering: ImageRendering,
|
|
colorize_property: Option<Pin<&Property<Brush>>>,
|
|
) {
|
|
// Caller ensured that zero/negative width/height resulted in an early return via get_geometry!.
|
|
debug_assert!(target_width.get() > 0.);
|
|
debug_assert!(target_height.get() > 0.);
|
|
|
|
let cached = item_cache.get_or_update(&self.cache, || {
|
|
// Query target_width/height here again to ensure that changes will invalidate the item rendering cache.
|
|
let target_width = target_width.get() as f64;
|
|
let target_height = target_height.get() as f64;
|
|
|
|
let has_source_clipping = source_rect.map_or(false, |rect| {
|
|
rect.is_valid()
|
|
&& (rect.x != 0.
|
|
|| rect.y != 0.
|
|
|| !rect.width.approx_eq(&target_width)
|
|
|| !rect.height.approx_eq(&target_height))
|
|
});
|
|
let source_size = if !has_source_clipping {
|
|
Some(qttypes::QSize { width: target_width as u32, height: target_height as u32 })
|
|
} else {
|
|
// Source size & clipping is not implemented yet
|
|
None
|
|
};
|
|
|
|
load_image_from_resource((&source_property.get()).into(), source_size, image_fit)
|
|
.map_or(QtRenderingCacheItem::Invalid, |mut pixmap: qttypes::QPixmap| {
|
|
let colorize = colorize_property.map_or(Brush::default(), |c| c.get());
|
|
if !colorize.is_transparent() {
|
|
let brush: QBrush = colorize.into();
|
|
cpp!(unsafe [mut pixmap as "QPixmap", brush as "QBrush"] {
|
|
QPainter p(&pixmap);
|
|
p.setCompositionMode(QPainter::CompositionMode_SourceIn);
|
|
p.fillRect(QRect(QPoint(), pixmap.size()), brush);
|
|
});
|
|
}
|
|
QtRenderingCacheItem::Pixmap(pixmap)
|
|
})
|
|
});
|
|
let pixmap: &qttypes::QPixmap = match &cached {
|
|
QtRenderingCacheItem::Pixmap(pixmap) => pixmap,
|
|
_ => return,
|
|
};
|
|
let image_size = pixmap.size();
|
|
let mut source_rect =
|
|
source_rect.filter(|r| r.is_valid()).unwrap_or_else(|| qttypes::QRectF {
|
|
x: 0.,
|
|
y: 0.,
|
|
width: image_size.width as _,
|
|
height: image_size.height as _,
|
|
});
|
|
let mut dest_rect = dest_rect;
|
|
adjust_to_image_fit(image_fit, &mut source_rect, &mut dest_rect);
|
|
let painter: &mut QPainter = &mut *self.painter;
|
|
let smooth: bool = rendering == ImageRendering::smooth;
|
|
cpp! { unsafe [
|
|
painter as "QPainter*",
|
|
pixmap as "QPixmap*",
|
|
source_rect as "QRectF",
|
|
dest_rect as "QRectF",
|
|
smooth as "bool"] {
|
|
painter->save();
|
|
painter->setRenderHint(QPainter::SmoothPixmapTransform, smooth);
|
|
painter->drawPixmap(dest_rect, *pixmap, source_rect);
|
|
painter->restore();
|
|
}};
|
|
}
|
|
|
|
fn draw_rectangle_impl(
|
|
painter: &mut QPainter,
|
|
mut rect: qttypes::QRectF,
|
|
brush: Brush,
|
|
border_color: Brush,
|
|
mut border_width: f32,
|
|
border_radius: f32,
|
|
) {
|
|
let brush: QBrush = brush.into();
|
|
let border_color: QBrush = border_color.into();
|
|
adjust_rect_and_border_for_inner_drawing(&mut rect, &mut border_width);
|
|
cpp! { unsafe [painter as "QPainter*", brush as "QBrush", border_color as "QBrush", border_width as "float", border_radius as "float", rect as "QRectF"] {
|
|
painter->setPen(border_width > 0 ? QPen(border_color, border_width) : Qt::NoPen);
|
|
painter->setBrush(brush);
|
|
if (border_radius > 0) {
|
|
painter->drawRoundedRect(rect, border_radius, border_radius);
|
|
} else {
|
|
painter->drawRect(rect);
|
|
}
|
|
}}
|
|
}
|
|
}
|
|
|
|
cpp_class!(unsafe struct QWidgetPtr as "std::unique_ptr<QWidget>");
|
|
|
|
pub struct QtWindow {
|
|
widget_ptr: QWidgetPtr,
|
|
pub(crate) self_weak: Weak<sixtyfps_corelib::window::Window>,
|
|
|
|
cache: QtRenderingCache,
|
|
}
|
|
|
|
impl QtWindow {
|
|
pub fn new(window_weak: &Weak<sixtyfps_corelib::window::Window>) -> Rc<Self> {
|
|
let widget_ptr = cpp! {unsafe [] -> QWidgetPtr as "std::unique_ptr<QWidget>" {
|
|
ensure_initialized();
|
|
return std::make_unique<SixtyFPSWidget>();
|
|
}};
|
|
let rc = Rc::new(QtWindow {
|
|
widget_ptr,
|
|
self_weak: window_weak.clone(),
|
|
cache: Default::default(),
|
|
});
|
|
let self_weak = Rc::downgrade(&rc);
|
|
let widget_ptr = rc.widget_ptr();
|
|
let rust_window = Rc::as_ptr(&rc);
|
|
cpp! {unsafe [widget_ptr as "SixtyFPSWidget*", rust_window as "void*"] {
|
|
widget_ptr->rust_window = rust_window;
|
|
}};
|
|
ALL_WINDOWS.with(|aw| aw.borrow_mut().push(self_weak));
|
|
rc
|
|
}
|
|
|
|
/// Return the QWidget*
|
|
fn widget_ptr(&self) -> NonNull<()> {
|
|
unsafe { std::mem::transmute_copy::<QWidgetPtr, NonNull<_>>(&self.widget_ptr) }
|
|
}
|
|
|
|
fn paint_event(&self, painter: &mut QPainter) {
|
|
let runtime_window = self.self_weak.upgrade().unwrap();
|
|
runtime_window.clone().draw_contents(|components| {
|
|
sixtyfps_corelib::animations::update_animations();
|
|
let cache = self.cache.clone();
|
|
let mut renderer = QtItemRenderer {
|
|
painter,
|
|
cache,
|
|
default_font_properties: self.default_font_properties(),
|
|
window: runtime_window,
|
|
};
|
|
|
|
for (component, origin) in components {
|
|
sixtyfps_corelib::item_rendering::render_component_items(
|
|
&component,
|
|
&mut renderer,
|
|
origin.clone(),
|
|
);
|
|
}
|
|
|
|
sixtyfps_corelib::animations::CURRENT_ANIMATION_DRIVER.with(|driver| {
|
|
if !driver.has_active_animations() {
|
|
return;
|
|
}
|
|
let widget_ptr = self.widget_ptr();
|
|
cpp! {unsafe [widget_ptr as "QWidget*"] {
|
|
// FIXME: using QTimer -::singleShot is not optimal. We should use Qt animation timer
|
|
QTimer::singleShot(16, [widget_ptr = QPointer<QWidget>(widget_ptr)] {
|
|
if (widget_ptr)
|
|
widget_ptr->update();
|
|
});
|
|
//return widget_ptr->update();
|
|
}}
|
|
});
|
|
});
|
|
}
|
|
|
|
fn resize_event(&self, size: qttypes::QSize) {
|
|
let component_rc = self.self_weak.upgrade().unwrap().component();
|
|
let component = ComponentRc::borrow_pin(&component_rc);
|
|
let root_item = component.as_ref().get_item_ref(0);
|
|
if let Some(window_item) = ItemRef::downcast_pin::<items::WindowItem>(root_item) {
|
|
window_item.width.set(size.width as _);
|
|
window_item.height.set(size.height as _);
|
|
}
|
|
}
|
|
|
|
fn mouse_event(&self, event: MouseEvent) {
|
|
self.self_weak.upgrade().unwrap().process_mouse_input(event);
|
|
timer_event();
|
|
}
|
|
|
|
fn key_event(&self, key: i32, text: qttypes::QString, qt_modifiers: u32, released: bool) {
|
|
sixtyfps_corelib::animations::update_animations();
|
|
let text: String = text.into();
|
|
let modifiers = sixtyfps_corelib::input::KeyboardModifiers {
|
|
control: (qt_modifiers & key_generated::Qt_KeyboardModifier_ControlModifier) != 0,
|
|
alt: (qt_modifiers & key_generated::Qt_KeyboardModifier_AltModifier) != 0,
|
|
shift: (qt_modifiers & key_generated::Qt_KeyboardModifier_ShiftModifier) != 0,
|
|
meta: (qt_modifiers & key_generated::Qt_KeyboardModifier_MetaModifier) != 0,
|
|
};
|
|
|
|
let text = qt_key_to_string(key as key_generated::Qt_Key, text);
|
|
|
|
let event = KeyEvent {
|
|
event_type: if released { KeyEventType::KeyReleased } else { KeyEventType::KeyPressed },
|
|
text,
|
|
modifiers,
|
|
};
|
|
self.self_weak.upgrade().unwrap().process_key_input(&event);
|
|
|
|
timer_event();
|
|
}
|
|
|
|
fn default_font_properties(&self) -> FontRequest {
|
|
self.self_weak.upgrade().unwrap().default_font_properties()
|
|
}
|
|
|
|
fn close_popup(&self) {
|
|
self.self_weak.upgrade().unwrap().close_popup();
|
|
}
|
|
}
|
|
|
|
#[allow(unused)]
|
|
impl PlatformWindow for QtWindow {
|
|
fn show(self: Rc<Self>) {
|
|
let component_rc = self.self_weak.upgrade().unwrap().component();
|
|
let component = ComponentRc::borrow_pin(&component_rc);
|
|
let root_item = component.as_ref().get_item_ref(0);
|
|
if let Some(window_item) = ItemRef::downcast_pin(root_item) {
|
|
self.apply_window_properties(window_item);
|
|
}
|
|
|
|
let widget_ptr = self.widget_ptr();
|
|
cpp! {unsafe [widget_ptr as "QWidget*"] {
|
|
widget_ptr->show();
|
|
}};
|
|
}
|
|
|
|
fn hide(self: Rc<Self>) {
|
|
let widget_ptr = self.widget_ptr();
|
|
cpp! {unsafe [widget_ptr as "QWidget*"] {
|
|
widget_ptr->hide();
|
|
}};
|
|
}
|
|
|
|
fn request_redraw(&self) {
|
|
let widget_ptr = self.widget_ptr();
|
|
cpp! {unsafe [widget_ptr as "QWidget*"] {
|
|
return widget_ptr->update();
|
|
}}
|
|
}
|
|
|
|
fn request_window_properties_update(&self) {
|
|
let widget_ptr = self.widget_ptr();
|
|
cpp! {unsafe [widget_ptr as "SixtyFPSWidget*"] {
|
|
QCoreApplication::postEvent(widget_ptr, new QEvent(QEvent::User));
|
|
}};
|
|
}
|
|
|
|
/// Apply windows property such as title to the QWidget*
|
|
fn apply_window_properties(&self, window_item: Pin<&items::WindowItem>) {
|
|
let widget_ptr = self.widget_ptr();
|
|
let title: qttypes::QString = window_item.title().as_str().into();
|
|
let no_frame = window_item.no_frame();
|
|
let mut size = qttypes::QSize {
|
|
width: window_item.width().ceil() as _,
|
|
height: window_item.height().ceil() as _,
|
|
};
|
|
if size.width == 0 || size.height == 0 {
|
|
let existing_size = cpp!(unsafe [widget_ptr as "QWidget*"] -> qttypes::QSize as "QSize" {
|
|
auto sizeHint = widget_ptr->sizeHint();
|
|
return sizeHint.isValid() ? sizeHint : widget_ptr->size();
|
|
});
|
|
if size.width == 0 {
|
|
window_item.width.set(existing_size.width as _);
|
|
size.width = existing_size.width;
|
|
}
|
|
if size.height == 0 {
|
|
window_item.height.set(existing_size.height as _);
|
|
size.height = existing_size.height;
|
|
}
|
|
}
|
|
let background: u32 = window_item.background().as_argb_encoded();
|
|
|
|
match (&window_item.icon()).into() {
|
|
&ImageInner::AbsoluteFilePath(ref path) => {
|
|
let icon_name: qttypes::QString = path.as_str().into();
|
|
cpp! {unsafe [widget_ptr as "QWidget*", icon_name as "QString"] {
|
|
widget_ptr->setWindowIcon(QIcon(icon_name));
|
|
}};
|
|
}
|
|
&ImageInner::None => (),
|
|
r => {
|
|
if let Some(pixmap) = load_image_from_resource(r, None, ImageFit::contain) {
|
|
cpp! {unsafe [widget_ptr as "QWidget*", pixmap as "QPixmap"] {
|
|
widget_ptr->setWindowIcon(QIcon(pixmap));
|
|
}};
|
|
}
|
|
}
|
|
};
|
|
|
|
cpp! {unsafe [widget_ptr as "QWidget*", title as "QString", size as "QSize", background as "QRgb", no_frame as "bool"] {
|
|
if (size != widget_ptr->size()) {
|
|
widget_ptr->resize(size.expandedTo({1, 1}));
|
|
}
|
|
if (no_frame) {
|
|
widget_ptr->setWindowFlags(Qt::FramelessWindowHint);
|
|
} else {
|
|
auto flags = widget_ptr->windowFlags();
|
|
widget_ptr->setWindowFlags(flags & (~Qt::FramelessWindowHint));
|
|
}
|
|
widget_ptr->setWindowTitle(title);
|
|
auto pal = widget_ptr->palette();
|
|
pal.setColor(QPalette::Window, QColor::fromRgba(background));
|
|
widget_ptr->setPalette(pal);
|
|
widget_ptr->show();
|
|
}};
|
|
}
|
|
|
|
/// Set the min/max sizes on the QWidget
|
|
fn apply_geometry_constraint(
|
|
&self,
|
|
constraints_h: sixtyfps_corelib::layout::LayoutInfo,
|
|
constraints_v: sixtyfps_corelib::layout::LayoutInfo,
|
|
) {
|
|
let widget_ptr = self.widget_ptr();
|
|
let min_width: f32 = constraints_h.min.min(constraints_h.max);
|
|
let min_height: f32 = constraints_v.min.min(constraints_v.max);
|
|
let mut max_width: f32 = constraints_h.max.max(constraints_h.min);
|
|
let mut max_height: f32 = constraints_v.max.max(constraints_v.min);
|
|
cpp! {unsafe [widget_ptr as "QWidget*", min_width as "float", min_height as "float", mut max_width as "float", mut max_height as "float"] {
|
|
widget_ptr->setMinimumSize(QSize(min_width, min_height));
|
|
if (max_width > QWIDGETSIZE_MAX)
|
|
max_width = QWIDGETSIZE_MAX;
|
|
if (max_height > QWIDGETSIZE_MAX)
|
|
max_height = QWIDGETSIZE_MAX;
|
|
widget_ptr->setMaximumSize(QSize(max_width, max_height).expandedTo({1,1}));
|
|
}};
|
|
}
|
|
|
|
fn free_graphics_resources<'a>(&self, items: &mut dyn Iterator<Item = Pin<ItemRef<'a>>>) {
|
|
for item in items {
|
|
let cached_rendering_data = item.cached_rendering_data_offset();
|
|
cached_rendering_data.release(&mut self.cache.borrow_mut());
|
|
}
|
|
}
|
|
|
|
fn show_popup(&self, popup: &sixtyfps_corelib::component::ComponentRc, position: Point) {
|
|
let window = sixtyfps_corelib::window::Window::new(|window| QtWindow::new(window));
|
|
let popup_window: &QtWindow =
|
|
<dyn std::any::Any>::downcast_ref(window.as_ref().as_any()).unwrap();
|
|
window.set_component(popup);
|
|
|
|
let runtime_window = self.self_weak.upgrade().unwrap();
|
|
let size = runtime_window.set_active_popup(PopupWindow {
|
|
location: PopupWindowLocation::TopLevel(window.clone()),
|
|
component: popup.clone(),
|
|
});
|
|
|
|
let size = qttypes::QSize { width: size.width as _, height: size.height as _ };
|
|
|
|
let popup_ptr = popup_window.widget_ptr();
|
|
let pos = qttypes::QPoint { x: position.x as _, y: position.y as _ };
|
|
let widget_ptr = self.widget_ptr();
|
|
cpp! {unsafe [widget_ptr as "QWidget*", popup_ptr as "QWidget*", pos as "QPoint", size as "QSize"] {
|
|
popup_ptr->setParent(widget_ptr, Qt::Popup);
|
|
popup_ptr->setGeometry(QRect(pos + widget_ptr->geometry().topLeft(), size));
|
|
popup_ptr->show();
|
|
}};
|
|
}
|
|
|
|
fn text_size(
|
|
&self,
|
|
font_request: sixtyfps_corelib::graphics::FontRequest,
|
|
text: &str,
|
|
max_width: Option<f32>,
|
|
) -> Size {
|
|
get_font(font_request.merge(&self.default_font_properties())).text_size(text, max_width)
|
|
}
|
|
|
|
fn text_input_byte_offset_for_position(
|
|
&self,
|
|
text_input: Pin<&sixtyfps_corelib::items::TextInput>,
|
|
pos: Point,
|
|
) -> usize {
|
|
let rect: qttypes::QRectF = get_geometry!(items::TextInput, text_input);
|
|
let pos = qttypes::QPointF { x: pos.x as _, y: pos.y as _ };
|
|
let font: QFont =
|
|
get_font(text_input.unresolved_font_request().merge(&self.default_font_properties()));
|
|
let string = qttypes::QString::from(text_input.text().as_str());
|
|
let flags = match text_input.horizontal_alignment() {
|
|
TextHorizontalAlignment::left => key_generated::Qt_AlignmentFlag_AlignLeft,
|
|
TextHorizontalAlignment::center => key_generated::Qt_AlignmentFlag_AlignHCenter,
|
|
TextHorizontalAlignment::right => key_generated::Qt_AlignmentFlag_AlignRight,
|
|
} | match text_input.vertical_alignment() {
|
|
TextVerticalAlignment::top => key_generated::Qt_AlignmentFlag_AlignTop,
|
|
TextVerticalAlignment::center => key_generated::Qt_AlignmentFlag_AlignVCenter,
|
|
TextVerticalAlignment::bottom => key_generated::Qt_AlignmentFlag_AlignBottom,
|
|
} | match text_input.wrap() {
|
|
TextWrap::no_wrap => 0,
|
|
TextWrap::word_wrap => key_generated::Qt_TextFlag_TextWordWrap,
|
|
};
|
|
let single_line: bool = text_input.single_line();
|
|
cpp! { unsafe [font as "QFont", string as "QString", pos as "QPointF", flags as "int", rect as "QRectF", single_line as "bool"] -> usize as "size_t" {
|
|
// we need to do the \n replacement in a copy because the original need to be kept to know the utf8 offset
|
|
auto copy = string;
|
|
if (!single_line) {
|
|
copy.replace(QChar('\n'), QChar::LineSeparator);
|
|
}
|
|
QTextLayout layout(copy, font);
|
|
auto line = do_text_layout(layout, flags, rect, pos.y());
|
|
if (line < 0 || layout.lineCount() <= line)
|
|
return 0;
|
|
QTextLine textLine = layout.lineAt(line);
|
|
int cur;
|
|
if (pos.x() > textLine.naturalTextWidth()) {
|
|
cur = textLine.textStart() + textLine.textLength();
|
|
if (cur > 0 && string[cur - 1] == '\n')
|
|
cur--;
|
|
} else {
|
|
cur = textLine.xToCursor(pos.x());
|
|
}
|
|
// convert to an utf8 pos;
|
|
return QStringView(string).left(cur).toUtf8().size();
|
|
}}
|
|
}
|
|
|
|
fn text_input_position_for_byte_offset(
|
|
&self,
|
|
text_input: Pin<&sixtyfps_corelib::items::TextInput>,
|
|
byte_offset: usize,
|
|
) -> Point {
|
|
let rect: qttypes::QRectF = get_geometry!(items::TextInput, text_input);
|
|
let font: QFont =
|
|
get_font(text_input.unresolved_font_request().merge(&self.default_font_properties()));
|
|
let text = text_input.text();
|
|
let mut string = qttypes::QString::from(text.as_str());
|
|
let offset: u32 = utf8_byte_offset_to_utf16_units(text.as_str(), byte_offset) as _;
|
|
let flags = match text_input.horizontal_alignment() {
|
|
TextHorizontalAlignment::left => key_generated::Qt_AlignmentFlag_AlignLeft,
|
|
TextHorizontalAlignment::center => key_generated::Qt_AlignmentFlag_AlignHCenter,
|
|
TextHorizontalAlignment::right => key_generated::Qt_AlignmentFlag_AlignRight,
|
|
} | match text_input.vertical_alignment() {
|
|
TextVerticalAlignment::top => key_generated::Qt_AlignmentFlag_AlignTop,
|
|
TextVerticalAlignment::center => key_generated::Qt_AlignmentFlag_AlignVCenter,
|
|
TextVerticalAlignment::bottom => key_generated::Qt_AlignmentFlag_AlignBottom,
|
|
} | match text_input.wrap() {
|
|
TextWrap::no_wrap => 0,
|
|
TextWrap::word_wrap => key_generated::Qt_TextFlag_TextWordWrap,
|
|
};
|
|
let single_line: bool = text_input.single_line();
|
|
let r = cpp! { unsafe [font as "QFont", mut string as "QString", offset as "int", flags as "int", rect as "QRectF", single_line as "bool"]
|
|
-> qttypes::QPointF as "QPointF" {
|
|
if (!single_line) {
|
|
string.replace(QChar('\n'), QChar::LineSeparator);
|
|
}
|
|
QTextLayout layout(string, font);
|
|
do_text_layout(layout, flags, rect);
|
|
|
|
QTextLine textLine = layout.lineForTextPosition(offset);
|
|
if (!textLine.isValid())
|
|
return QPointF();
|
|
return QPointF(textLine.x() + textLine.cursorToX(offset), textLine.y());
|
|
}};
|
|
return Point::new(r.x as _, r.y as _);
|
|
}
|
|
|
|
fn as_any(&self) -> &dyn std::any::Any {
|
|
self
|
|
}
|
|
}
|
|
|
|
fn get_font(request: FontRequest) -> QFont {
|
|
let family: qttypes::QString = request.family.unwrap_or_default().as_str().into();
|
|
let pixel_size: f32 = request.pixel_size.unwrap_or(0.);
|
|
let weight: i32 = request.weight.unwrap_or(0);
|
|
let letter_spacing: f32 = request.letter_spacing.unwrap_or_default();
|
|
cpp!(unsafe [family as "QString", pixel_size as "float", weight as "int", letter_spacing as "float"] -> QFont as "QFont" {
|
|
QFont f;
|
|
if (!family.isEmpty())
|
|
f.setFamily(family);
|
|
if (pixel_size > 0)
|
|
f.setPixelSize(pixel_size);
|
|
if (weight > 0) {
|
|
#if QT_VERSION < QT_VERSION_CHECK(6, 0, 0)
|
|
f.setWeight(qMin((weight-100)/8, 99));
|
|
#else
|
|
f.setWeight(QFont::Weight(weight));
|
|
#endif
|
|
}
|
|
f.setLetterSpacing(QFont::AbsoluteSpacing, letter_spacing);
|
|
// Mark all font properties as resolved, to avoid inheriting font properties
|
|
// from the widget hierarchy. Later we call QPainter::setFont, which would
|
|
// merge in unset properties (such as bold, etc.) that it retrieved from
|
|
// the widget the painter is associated with.
|
|
#if QT_VERSION < QT_VERSION_CHECK(6, 0, 0)
|
|
f.resolve(QFont::AllPropertiesResolved);
|
|
#else
|
|
f.setResolveMask(QFont::AllPropertiesResolved);
|
|
#endif
|
|
return f;
|
|
})
|
|
}
|
|
|
|
cpp_class! {pub unsafe struct QFont as "QFont"}
|
|
|
|
impl QFont {
|
|
fn text_size(&self, text: &str, max_width: Option<f32>) -> sixtyfps_corelib::graphics::Size {
|
|
let string = qttypes::QString::from(text);
|
|
let mut r = qttypes::QRectF::default();
|
|
if let Some(max) = max_width {
|
|
r.height = f32::MAX as _;
|
|
r.width = max as _;
|
|
}
|
|
let size = cpp! { unsafe [self as "const QFont*", string as "QString", r as "QRectF"]
|
|
-> qttypes::QSizeF as "QSizeF"{
|
|
return QFontMetricsF(*self).boundingRect(r, r.isEmpty() ? 0 : Qt::TextWordWrap , string).size();
|
|
}};
|
|
sixtyfps_corelib::graphics::Size::new(size.width as _, size.height as _)
|
|
}
|
|
}
|
|
|
|
thread_local! {
|
|
// FIXME: currently the window are never removed
|
|
static ALL_WINDOWS: RefCell<Vec<Weak<QtWindow>>> = Default::default();
|
|
}
|
|
|
|
/// Called by C++'s TimerHandler::timerEvent, or every time a timer might have been started
|
|
pub(crate) fn timer_event() {
|
|
sixtyfps_corelib::animations::update_animations();
|
|
sixtyfps_corelib::timers::TimerList::maybe_activate_timers();
|
|
|
|
sixtyfps_corelib::animations::CURRENT_ANIMATION_DRIVER.with(|driver| {
|
|
if !driver.has_active_animations() {
|
|
return;
|
|
}
|
|
|
|
ALL_WINDOWS.with(|windows| {
|
|
for x in windows.borrow().iter() {
|
|
if let Some(x) = x.upgrade() {
|
|
x.request_redraw();
|
|
}
|
|
}
|
|
});
|
|
});
|
|
|
|
let mut timeout = sixtyfps_corelib::timers::TimerList::next_timeout().map(|instant| {
|
|
let now = std::time::Instant::now();
|
|
if instant > now {
|
|
instant.duration_since(now).as_millis() as i32
|
|
} else {
|
|
0
|
|
}
|
|
});
|
|
if sixtyfps_corelib::animations::CURRENT_ANIMATION_DRIVER
|
|
.with(|driver| driver.has_active_animations())
|
|
{
|
|
timeout = timeout.map(|x| x.max(16)).or(Some(16));
|
|
};
|
|
if let Some(timeout) = timeout {
|
|
cpp! { unsafe [timeout as "int"] {
|
|
ensure_initialized();
|
|
TimerHandler::instance().timer.start(timeout, &TimerHandler::instance());
|
|
}}
|
|
}
|
|
}
|
|
|
|
fn qt_key_to_string(key: key_generated::Qt_Key, event_text: String) -> SharedString {
|
|
// First try to see if we received one of the non-ascii keys that we have
|
|
// a special representation for. If that fails, try to use the provided
|
|
// text. If that's empty, then try to see if the provided key has an ascii
|
|
// representation. The last step is needed because modifiers may result in
|
|
// the text to be empty otherwise, for example Ctrl+C.
|
|
if let Some(special_key_code) = match key as key_generated::Qt_Key {
|
|
key_generated::Qt_Key_Key_Left => Some(InternalKeyCode::Left),
|
|
key_generated::Qt_Key_Key_Right => Some(InternalKeyCode::Right),
|
|
key_generated::Qt_Key_Key_Backspace => Some(InternalKeyCode::Back),
|
|
key_generated::Qt_Key_Key_Delete => Some(InternalKeyCode::Delete),
|
|
key_generated::Qt_Key_Key_End => Some(InternalKeyCode::End),
|
|
key_generated::Qt_Key_Key_Home => Some(InternalKeyCode::Home),
|
|
key_generated::Qt_Key_Key_Return => Some(InternalKeyCode::Return),
|
|
key_generated::Qt_Key_Key_Enter => Some(InternalKeyCode::Return),
|
|
_ => None,
|
|
} {
|
|
return special_key_code.encode_to_string();
|
|
};
|
|
|
|
// On Windows, X11 and Wayland, Ctrl+C for example sends a terminal control character,
|
|
// which we choose not to supply to the application. Instead we fall through to translating
|
|
// the supplied key code.
|
|
if !event_text.is_empty() && !event_text.chars().any(|ch| ch.is_control()) {
|
|
return event_text.into();
|
|
}
|
|
|
|
match key {
|
|
key_generated::Qt_Key_Key_Space => " ",
|
|
key_generated::Qt_Key_Key_Exclam => "!",
|
|
key_generated::Qt_Key_Key_QuoteDbl => "\"",
|
|
key_generated::Qt_Key_Key_NumberSign => "#",
|
|
key_generated::Qt_Key_Key_Dollar => "$",
|
|
key_generated::Qt_Key_Key_Percent => "%",
|
|
key_generated::Qt_Key_Key_Ampersand => "&",
|
|
key_generated::Qt_Key_Key_Apostrophe => "'",
|
|
key_generated::Qt_Key_Key_ParenLeft => "(",
|
|
key_generated::Qt_Key_Key_ParenRight => ")",
|
|
key_generated::Qt_Key_Key_Asterisk => "*",
|
|
key_generated::Qt_Key_Key_Plus => "+",
|
|
key_generated::Qt_Key_Key_Comma => ",",
|
|
key_generated::Qt_Key_Key_Minus => "-",
|
|
key_generated::Qt_Key_Key_Period => ".",
|
|
key_generated::Qt_Key_Key_Slash => "/",
|
|
key_generated::Qt_Key_Key_0 => "0",
|
|
key_generated::Qt_Key_Key_1 => "1",
|
|
key_generated::Qt_Key_Key_2 => "2",
|
|
key_generated::Qt_Key_Key_3 => "3",
|
|
key_generated::Qt_Key_Key_4 => "4",
|
|
key_generated::Qt_Key_Key_5 => "5",
|
|
key_generated::Qt_Key_Key_6 => "6",
|
|
key_generated::Qt_Key_Key_7 => "7",
|
|
key_generated::Qt_Key_Key_8 => "8",
|
|
key_generated::Qt_Key_Key_9 => "9",
|
|
key_generated::Qt_Key_Key_Colon => ":",
|
|
key_generated::Qt_Key_Key_Semicolon => ";",
|
|
key_generated::Qt_Key_Key_Less => "<",
|
|
key_generated::Qt_Key_Key_Equal => "=",
|
|
key_generated::Qt_Key_Key_Greater => ">",
|
|
key_generated::Qt_Key_Key_Question => "?",
|
|
key_generated::Qt_Key_Key_At => "@",
|
|
key_generated::Qt_Key_Key_A => "a",
|
|
key_generated::Qt_Key_Key_B => "b",
|
|
key_generated::Qt_Key_Key_C => "c",
|
|
key_generated::Qt_Key_Key_D => "d",
|
|
key_generated::Qt_Key_Key_E => "e",
|
|
key_generated::Qt_Key_Key_F => "f",
|
|
key_generated::Qt_Key_Key_G => "g",
|
|
key_generated::Qt_Key_Key_H => "h",
|
|
key_generated::Qt_Key_Key_I => "i",
|
|
key_generated::Qt_Key_Key_J => "j",
|
|
key_generated::Qt_Key_Key_K => "k",
|
|
key_generated::Qt_Key_Key_L => "l",
|
|
key_generated::Qt_Key_Key_M => "m",
|
|
key_generated::Qt_Key_Key_N => "n",
|
|
key_generated::Qt_Key_Key_O => "o",
|
|
key_generated::Qt_Key_Key_P => "p",
|
|
key_generated::Qt_Key_Key_Q => "q",
|
|
key_generated::Qt_Key_Key_R => "r",
|
|
key_generated::Qt_Key_Key_S => "s",
|
|
key_generated::Qt_Key_Key_T => "t",
|
|
key_generated::Qt_Key_Key_U => "u",
|
|
key_generated::Qt_Key_Key_V => "v",
|
|
key_generated::Qt_Key_Key_W => "w",
|
|
key_generated::Qt_Key_Key_X => "x",
|
|
key_generated::Qt_Key_Key_Y => "y",
|
|
key_generated::Qt_Key_Key_Z => "z",
|
|
key_generated::Qt_Key_Key_BracketLeft => "[",
|
|
key_generated::Qt_Key_Key_Backslash => "\\",
|
|
key_generated::Qt_Key_Key_BracketRight => "]",
|
|
key_generated::Qt_Key_Key_AsciiCircum => "^",
|
|
key_generated::Qt_Key_Key_Underscore => "_",
|
|
key_generated::Qt_Key_Key_QuoteLeft => "`",
|
|
key_generated::Qt_Key_Key_BraceLeft => "{",
|
|
key_generated::Qt_Key_Key_Bar => "|",
|
|
key_generated::Qt_Key_Key_BraceRight => "}",
|
|
key_generated::Qt_Key_Key_AsciiTilde => "~",
|
|
_ => "",
|
|
}
|
|
.into()
|
|
}
|
|
|
|
pub(crate) mod ffi {
|
|
use std::ffi::c_void;
|
|
|
|
use super::QtWindow;
|
|
|
|
#[no_mangle]
|
|
pub extern "C" fn sixtyfps_qt_get_widget(
|
|
window: &sixtyfps_corelib::window::WindowRc,
|
|
) -> *mut c_void {
|
|
<dyn std::any::Any>::downcast_ref(window.as_any())
|
|
.map_or(std::ptr::null_mut(), |win: &QtWindow| {
|
|
win.widget_ptr().cast::<c_void>().as_ptr()
|
|
})
|
|
}
|
|
}
|
|
|
|
fn utf8_byte_offset_to_utf16_units(str: &str, byte_offset: usize) -> usize {
|
|
let mut current_offset = 0;
|
|
let mut utf16_units = 0;
|
|
for ch in str.chars() {
|
|
if current_offset >= byte_offset {
|
|
break;
|
|
}
|
|
current_offset += ch.len_utf8();
|
|
utf16_units += ch.len_utf16();
|
|
}
|
|
utf16_units
|
|
}
|
|
|
|
#[test]
|
|
fn test_utf8_byte_offset_to_utf16_units() {
|
|
assert_eq!(utf8_byte_offset_to_utf16_units("Hello", 2), 2);
|
|
|
|
{
|
|
let test_str = "a🚀🍌";
|
|
assert_eq!(test_str.encode_utf16().count(), 5);
|
|
|
|
let banana_offset = test_str.char_indices().nth(2).unwrap().0;
|
|
|
|
assert_eq!(
|
|
utf8_byte_offset_to_utf16_units(test_str, banana_offset),
|
|
// 'a' encodes as one utf-16 unit, the rocket ship requires two units
|
|
3
|
|
);
|
|
}
|
|
}
|